C8H15NO4 — CID 141007799
N-(2-methoxyethyl)-1,3-dioxane-5-carboxamide (PubChem CID 141007799) has the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1,3-dioxane-5-carboxamide.
| Compound Name | N-(2-methoxyethyl)-1,3-dioxane-5-carboxamide |
|---|---|
| PubChem CID | 141007799 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | N-(2-methoxyethyl)-1,3-dioxane-5-carboxamide |
| SMILES | COCCNC(=O)C1COCOC1 |
| InChI | InChI=1S/C8H15NO4/c1-11-3-2-9-8(10)7-4-12-6-13-5-7/h7H,2-6H2,1H3,(H,9,10) |
| InChIKey | YEEGULMASMORFP-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|