C9H17NO4S — CID 110849249
N-(2-methoxyethyl)-1,1-dioxothiane-3-carboxamide (PubChem CID 110849249) has the molecular formula C9H17NO4S and a molecular weight of 235.30 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1,1-dioxothiane-3-carboxamide.
| Compound Name | N-(2-methoxyethyl)-1,1-dioxothiane-3-carboxamide |
|---|---|
| PubChem CID | 110849249 |
| Molecular Formula | C9H17NO4S |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | N-(2-methoxyethyl)-1,1-dioxothiane-3-carboxamide |
| SMILES | COCCNC(=O)C1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H17NO4S/c1-14-5-4-10-9(11)8-3-2-6-15(12,13)7-8/h8H,2-7H2,1H3,(H,10,11) |
| InChIKey | MWFRKLWONPZPIA-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|