C12H9Cl2N5OS — CID 110401568
2,4-dichloro-N-[2-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]benzamide (PubChem CID 110401568) has the molecular formula C12H9Cl2N5OS and a molecular weight of 342.21 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 110401568 |
| Molecular Formula | C12H9Cl2N5OS |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 2,4-dichloro-N-[2-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1nn2cnnc2s1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H9Cl2N5OS/c13-7-1-2-8(9(14)5-7)11(20)15-4-3-10-18-19-6-16-17-12(19)21-10/h1-2,5-6H,3-4H2,(H,15,20) |
| InChIKey | NKSNFYXLCUJFMU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |