C11H7F2N5OS — CID 110401733
3,4-difluoro-N-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-ylmethyl)benzamide (PubChem CID 110401733) has the molecular formula C11H7F2N5OS and a molecular weight of 295.27 g/mol. Its IUPAC name is 3,4-difluoro-N-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-ylmethyl)benzamide.
| Compound Name | 3,4-difluoro-N-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-ylmethyl)benzamide |
|---|---|
| PubChem CID | 110401733 |
| Molecular Formula | C11H7F2N5OS |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 3,4-difluoro-N-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-ylmethyl)benzamide |
| SMILES | O=C(NCc1nn2cnnc2s1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H7F2N5OS/c12-7-2-1-6(3-8(7)13)10(19)14-4-9-17-18-5-15-16-11(18)20-9/h1-3,5H,4H2,(H,14,19) |
| InChIKey | KOZFGADOWPGPNA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |