C9H13N5OS — CID 110401669
2,2-dimethyl-N-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-ylmethyl)propanamide (PubChem CID 110401669) has the molecular formula C9H13N5OS and a molecular weight of 239.30 g/mol. Its IUPAC name is 2,2-dimethyl-N-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-ylmethyl)propanamide.
| Compound Name | 2,2-dimethyl-N-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-ylmethyl)propanamide |
|---|---|
| PubChem CID | 110401669 |
| Molecular Formula | C9H13N5OS |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 2,2-dimethyl-N-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-ylmethyl)propanamide |
| SMILES | CC(C)(C)C(=O)NCc1nn2cnnc2s1 |
| InChI | InChI=1S/C9H13N5OS/c1-9(2,3)7(15)10-4-6-13-14-5-11-12-8(14)16-6/h5H,4H2,1-3H3,(H,10,15) |
| InChIKey | IOZNEJNSSOLGEZ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |