C23H33N3O3 — CID 110414432
tert-butyl 2-[4-[(E)-3-phenylprop-2-enyl]piperazine-1-carbonyl]pyrrolidine-1-carboxylate (PubChem CID 110414432) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is tert-butyl 2-[4-[(E)-3-phenylprop-2-enyl]piperazine-1-carbonyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[4-[(E)-3-phenylprop-2-enyl]piperazine-1-carbonyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 110414432 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | tert-butyl 2-[4-[(E)-3-phenylprop-2-enyl]piperazine-1-carbonyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C(=O)N1CCN(C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C23H33N3O3/c1-23(2,3)29-22(28)26-14-8-12-20(26)21(27)25-17-15-24(16-18-25)13-7-11-19-9-5-4-6-10-19/h4-7,9-11,20H,8,12-18H2,1-3H3/b11-7+ |
| InChIKey | OWAHKHGOXSCUIL-YRNVUSSQSA-N |
| XLogP | 3.24 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |