C20H20N4O3 — CID 110427297
[3-(2-methylpropyl)imidazo[1,5-a]pyridin-1-yl]-(6-nitro-2,3-dihydroindol-1-yl)methanone (PubChem CID 110427297) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is [3-(2-methylpropyl)imidazo[1,5-a]pyridin-1-yl]-(6-nitro-2,3-dihydroindol-1-yl)methanone.
| Compound Name | [3-(2-methylpropyl)imidazo[1,5-a]pyridin-1-yl]-(6-nitro-2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 110427297 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | [3-(2-methylpropyl)imidazo[1,5-a]pyridin-1-yl]-(6-nitro-2,3-dihydroindol-1-yl)methanone |
| SMILES | CC(C)Cc1nc(C(=O)N2CCc3ccc([N+](=O)[O-])cc32)c2ccccn12 |
| InChI | InChI=1S/C20H20N4O3/c1-13(2)11-18-21-19(16-5-3-4-9-22(16)18)20(25)23-10-8-14-6-7-15(24(26)27)12-17(14)23/h3-7,9,12-13H,8,10-11H2,1-2H3 |
| InChIKey | ATYFLRTUDCKGNR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|