C24H22N4O4S — CID 1104332
3-methoxy-4-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]-N-phenylbenzenesulfonamide (PubChem CID 1104332) has the molecular formula C24H22N4O4S and a molecular weight of 462.53 g/mol. Its IUPAC name is 3-methoxy-4-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]-N-phenylbenzenesulfonamide.
| Compound Name | 3-methoxy-4-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 1104332 |
| Molecular Formula | C24H22N4O4S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 3-methoxy-4-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]-N-phenylbenzenesulfonamide |
| SMILES | COc1cc(S(=O)(=O)Nc2ccccc2)ccc1/N=C/c1c(C)[nH]n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C24H22N4O4S/c1-17-21(24(29)28(26-17)19-11-7-4-8-12-19)16-25-22-14-13-20(15-23(22)32-2)33(30,31)27-18-9-5-3-6-10-18/h3-16,26-27H,1-2H3/b25-16+ |
| InChIKey | QWVRSBSBDRKDAU-PCLIKHOPSA-N |
| XLogP | 4.03 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|