C21H24N4O3S — CID 135601269
N-ethyl-4-[4-[(2-ethylphenyl)iminomethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzenesulfonamide (PubChem CID 135601269) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is N-ethyl-4-[4-[(2-ethylphenyl)iminomethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzenesulfonamide.
| Compound Name | N-ethyl-4-[4-[(2-ethylphenyl)iminomethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 135601269 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-ethyl-4-[4-[(2-ethylphenyl)iminomethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(-n2[nH]c(C)c(/C=N/c3ccccc3CC)c2=O)cc1 |
| InChI | InChI=1S/C21H24N4O3S/c1-4-16-8-6-7-9-20(16)22-14-19-15(3)24-25(21(19)26)17-10-12-18(13-11-17)29(27,28)23-5-2/h6-14,23-24H,4-5H2,1-3H3/b22-14+ |
| InChIKey | HLTVLRKOMCTEPI-HYARGMPZSA-N |
| XLogP | 3.09 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|