C21H22N4O5S — CID 135849531
2-[4-[(2-ethylphenyl)iminomethyl]-2-[4-(methanesulfonamido)phenyl]-3-oxo-1H-pyrazol-5-yl]acetic acid (PubChem CID 135849531) has the molecular formula C21H22N4O5S and a molecular weight of 442.50 g/mol. Its IUPAC name is 2-[4-[(2-ethylphenyl)iminomethyl]-2-[4-(methanesulfonamido)phenyl]-3-oxo-1H-pyrazol-5-yl]acetic acid.
| Compound Name | 2-[4-[(2-ethylphenyl)iminomethyl]-2-[4-(methanesulfonamido)phenyl]-3-oxo-1H-pyrazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 135849531 |
| Molecular Formula | C21H22N4O5S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 2-[4-[(2-ethylphenyl)iminomethyl]-2-[4-(methanesulfonamido)phenyl]-3-oxo-1H-pyrazol-5-yl]acetic acid |
| SMILES | CCc1ccccc1/N=C/c1c(CC(=O)O)[nH]n(-c2ccc(NS(C)(=O)=O)cc2)c1=O |
| InChI | InChI=1S/C21H22N4O5S/c1-3-14-6-4-5-7-18(14)22-13-17-19(12-20(26)27)23-25(21(17)28)16-10-8-15(9-11-16)24-31(2,29)30/h4-11,13,23-24H,3,12H2,1-2H3,(H,26,27)/b22-13+ |
| InChIKey | PFTOLBLWGQNJNP-LPYMAVHISA-N |
| XLogP | 2.48 |
| TPSA | 133.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|