C24H28N4O2 — CID 135601256
N,N-diethyl-4-[4-[(2-ethylphenyl)iminomethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzamide (PubChem CID 135601256) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is N,N-diethyl-4-[4-[(2-ethylphenyl)iminomethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzamide.
| Compound Name | N,N-diethyl-4-[4-[(2-ethylphenyl)iminomethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzamide |
|---|---|
| PubChem CID | 135601256 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | N,N-diethyl-4-[4-[(2-ethylphenyl)iminomethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzamide |
| SMILES | CCc1ccccc1/N=C/c1c(C)[nH]n(-c2ccc(C(=O)N(CC)CC)cc2)c1=O |
| InChI | InChI=1S/C24H28N4O2/c1-5-18-10-8-9-11-22(18)25-16-21-17(4)26-28(24(21)30)20-14-12-19(13-15-20)23(29)27(6-2)7-3/h8-16,26H,5-7H2,1-4H3/b25-16+ |
| InChIKey | PSZCLMWKVXARJZ-PCLIKHOPSA-N |
| XLogP | 4.27 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|