C31H39N5O3S — CID 135601287
N,N-diethyl-4-[4-[(2-ethylphenyl)iminomethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzenesulfonamide;2-ethylaniline (PubChem CID 135601287) has the molecular formula C31H39N5O3S and a molecular weight of 561.75 g/mol. Its IUPAC name is N,N-diethyl-4-[4-[(2-ethylphenyl)iminomethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzenesulfonamide;2-ethylaniline.
| Compound Name | N,N-diethyl-4-[4-[(2-ethylphenyl)iminomethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzenesulfonamide;2-ethylaniline |
|---|---|
| PubChem CID | 135601287 |
| Molecular Formula | C31H39N5O3S |
| Molecular Weight | 561.75 g/mol |
| Exact Mass | 561.28 |
| IUPAC Name | N,N-diethyl-4-[4-[(2-ethylphenyl)iminomethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzenesulfonamide;2-ethylaniline |
| SMILES | CCc1ccccc1/N=C/c1c(C)[nH]n(-c2ccc(S(=O)(=O)N(CC)CC)cc2)c1=O.CCc1ccccc1N |
| InChI | InChI=1S/C23H28N4O3S.C8H11N/c1-5-18-10-8-9-11-22(18)24-16-21-17(4)25-27(23(21)28)19-12-14-20(15-13-19)31(29,30)26(6-2)7-3;1-2-7-5-3-4-6-8(7)9/h8-16,25H,5-7H2,1-4H3;3-6H,2,9H2,1H3/b24-16+; |
| InChIKey | RMVVJGHJYOEORU-RSOFWHLMSA-N |
| XLogP | 5.65 |
| TPSA | 113.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.75 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|