C10H16N4O4 — CID 11043345
tert-butyl N-[1-[2-(hydroxyamino)-2-oxoethyl]imidazol-4-yl]carbamate (PubChem CID 11043345) has the molecular formula C10H16N4O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(hydroxyamino)-2-oxoethyl]imidazol-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-(hydroxyamino)-2-oxoethyl]imidazol-4-yl]carbamate |
|---|---|
| PubChem CID | 11043345 |
| Molecular Formula | C10H16N4O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | tert-butyl N-[1-[2-(hydroxyamino)-2-oxoethyl]imidazol-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cn(CC(=O)NO)cn1 |
| InChI | InChI=1S/C10H16N4O4/c1-10(2,3)18-9(16)12-7-4-14(6-11-7)5-8(15)13-17/h4,6,17H,5H2,1-3H3,(H,12,16)(H,13,15) |
| InChIKey | CCNDGFPYPMWCOW-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|