C15H14N4O2 — CID 110435174
N-(3,4-dimethoxyphenyl)pyrido[2,3-d]pyrimidin-4-amine (PubChem CID 110435174) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)pyrido[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(3,4-dimethoxyphenyl)pyrido[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 110435174 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)pyrido[2,3-d]pyrimidin-4-amine |
| SMILES | COc1ccc(Nc2ncnc3ncccc23)cc1OC |
| InChI | InChI=1S/C15H14N4O2/c1-20-12-6-5-10(8-13(12)21-2)19-15-11-4-3-7-16-14(11)17-9-18-15/h3-9H,1-2H3,(H,16,17,18,19) |
| InChIKey | DYJHBFVTJUFDMX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |