C14H20O5 — CID 11043766
[(1R,5S,6S,9R,11S,13R)-6-(hydroxymethyl)-4,8-dioxatetracyclo[7.2.2.01,5.06,11]tridecan-13-yl] acetate (PubChem CID 11043766) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is [(1R,5S,6S,9R,11S,13R)-6-(hydroxymethyl)-4,8-dioxatetracyclo[7.2.2.01,5.06,11]tridecan-13-yl] acetate.
| Compound Name | [(1R,5S,6S,9R,11S,13R)-6-(hydroxymethyl)-4,8-dioxatetracyclo[7.2.2.01,5.06,11]tridecan-13-yl] acetate |
|---|---|
| PubChem CID | 11043766 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | [(1R,5S,6S,9R,11S,13R)-6-(hydroxymethyl)-4,8-dioxatetracyclo[7.2.2.01,5.06,11]tridecan-13-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@]23CCO[C@@H]2[C@@]2(CO)CO[C@@H]1C[C@H]23 |
| InChI | InChI=1S/C14H20O5/c1-8(16)19-10-5-13-2-3-17-12(13)14(6-15)7-18-9(10)4-11(13)14/h9-12,15H,2-7H2,1H3/t9-,10-,11+,12+,13-,14+/m1/s1 |
| InChIKey | HBPBLLCJMJCANC-WCQYUDONSA-N |
| XLogP | 0.49 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |