C17H22N2O4S — CID 110443343
3,4,5-trimethoxy-N-[(4-propan-2-yl-1,3-thiazol-2-yl)methyl]benzamide (PubChem CID 110443343) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[(4-propan-2-yl-1,3-thiazol-2-yl)methyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[(4-propan-2-yl-1,3-thiazol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 110443343 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 3,4,5-trimethoxy-N-[(4-propan-2-yl-1,3-thiazol-2-yl)methyl]benzamide |
| SMILES | COc1cc(C(=O)NCc2nc(C(C)C)cs2)cc(OC)c1OC |
| InChI | InChI=1S/C17H22N2O4S/c1-10(2)12-9-24-15(19-12)8-18-17(20)11-6-13(21-3)16(23-5)14(7-11)22-4/h6-7,9-10H,8H2,1-5H3,(H,18,20) |
| InChIKey | LGGWWDQKWSHUPT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |