C19H26N2O2 — CID 110448861
6-tert-butyl-3-oxo-2-(3-propan-2-yloxypropyl)-1H-isoindole-1-carbonitrile (PubChem CID 110448861) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 6-tert-butyl-3-oxo-2-(3-propan-2-yloxypropyl)-1H-isoindole-1-carbonitrile.
| Compound Name | 6-tert-butyl-3-oxo-2-(3-propan-2-yloxypropyl)-1H-isoindole-1-carbonitrile |
|---|---|
| PubChem CID | 110448861 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 6-tert-butyl-3-oxo-2-(3-propan-2-yloxypropyl)-1H-isoindole-1-carbonitrile |
| SMILES | CC(C)OCCCN1C(=O)c2ccc(C(C)(C)C)cc2C1C#N |
| InChI | InChI=1S/C19H26N2O2/c1-13(2)23-10-6-9-21-17(12-20)16-11-14(19(3,4)5)7-8-15(16)18(21)22/h7-8,11,13,17H,6,9-10H2,1-5H3 |
| InChIKey | BXRQGPXZFRAYIL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|