C13H12Cl2N2O3 — CID 110449223
4,6-dichloro-2-[2-(2-hydroxyethoxy)ethyl]-3-oxo-1H-isoindole-1-carbonitrile (PubChem CID 110449223) has the molecular formula C13H12Cl2N2O3 and a molecular weight of 315.16 g/mol. Its IUPAC name is 4,6-dichloro-2-[2-(2-hydroxyethoxy)ethyl]-3-oxo-1H-isoindole-1-carbonitrile.
| Compound Name | 4,6-dichloro-2-[2-(2-hydroxyethoxy)ethyl]-3-oxo-1H-isoindole-1-carbonitrile |
|---|---|
| PubChem CID | 110449223 |
| Molecular Formula | C13H12Cl2N2O3 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 4,6-dichloro-2-[2-(2-hydroxyethoxy)ethyl]-3-oxo-1H-isoindole-1-carbonitrile |
| SMILES | N#CC1c2cc(Cl)cc(Cl)c2C(=O)N1CCOCCO |
| InChI | InChI=1S/C13H12Cl2N2O3/c14-8-5-9-11(7-16)17(1-3-20-4-2-18)13(19)12(9)10(15)6-8/h5-6,11,18H,1-4H2 |
| InChIKey | UUAORQFYDZWTLA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|