C10H16O2 — CID 11045033
3-(4-methoxycyclohexa-1,3-dien-1-yl)propan-1-ol (PubChem CID 11045033) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 3-(4-methoxycyclohexa-1,3-dien-1-yl)propan-1-ol.
| Compound Name | 3-(4-methoxycyclohexa-1,3-dien-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 11045033 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 3-(4-methoxycyclohexa-1,3-dien-1-yl)propan-1-ol |
| SMILES | COC1=CC=C(CCCO)CC1 |
| InChI | InChI=1S/C10H16O2/c1-12-10-6-4-9(5-7-10)3-2-8-11/h4,6,11H,2-3,5,7-8H2,1H3 |
| InChIKey | TVZORZUMEIQISH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |