C13H16FeO5 — CID 11045032
carbon monoxide;iron;3-(4-methoxycyclohexa-1,3-dien-1-yl)propan-1-ol (PubChem CID 11045032) has the molecular formula C13H16FeO5 and a molecular weight of 308.11 g/mol. Its IUPAC name is carbon monoxide;iron;3-(4-methoxycyclohexa-1,3-dien-1-yl)propan-1-ol.
| Compound Name | carbon monoxide;iron;3-(4-methoxycyclohexa-1,3-dien-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 11045032 |
| Molecular Formula | C13H16FeO5 |
| Molecular Weight | 308.11 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | carbon monoxide;iron;3-(4-methoxycyclohexa-1,3-dien-1-yl)propan-1-ol |
| SMILES | COC1=CC=C(CCCO)CC1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe] |
| InChI | InChI=1S/C10H16O2.3CO.Fe/c1-12-10-6-4-9(5-7-10)3-2-8-11;3*1-2;/h4,6,11H,2-3,5,7-8H2,1H3;;;; |
| InChIKey | AKMRLWKDTKVAEU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.11 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|