C18H19FN2O3 — CID 110452691
2-fluoro-5-[4-(2-methoxyphenyl)piperazin-1-yl]benzoic acid (PubChem CID 110452691) has the molecular formula C18H19FN2O3 and a molecular weight of 330.36 g/mol. Its IUPAC name is 2-fluoro-5-[4-(2-methoxyphenyl)piperazin-1-yl]benzoic acid.
| Compound Name | 2-fluoro-5-[4-(2-methoxyphenyl)piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 110452691 |
| Molecular Formula | C18H19FN2O3 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-fluoro-5-[4-(2-methoxyphenyl)piperazin-1-yl]benzoic acid |
| SMILES | COc1ccccc1N1CCN(c2ccc(F)c(C(=O)O)c2)CC1 |
| InChI | InChI=1S/C18H19FN2O3/c1-24-17-5-3-2-4-16(17)21-10-8-20(9-11-21)13-6-7-15(19)14(12-13)18(22)23/h2-7,12H,8-11H2,1H3,(H,22,23) |
| InChIKey | LIPTWOQMRZJPTR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |