C18H22N4O5 — CID 24812703
azanium 5-[4-(2-methoxyphenyl)piperazin-1-yl]-2-nitrobenzoate (PubChem CID 24812703) has the molecular formula C18H22N4O5 and a molecular weight of 374.40 g/mol. Its IUPAC name is azanium 5-[4-(2-methoxyphenyl)piperazin-1-yl]-2-nitrobenzoate.
| Compound Name | azanium 5-[4-(2-methoxyphenyl)piperazin-1-yl]-2-nitrobenzoate |
|---|---|
| PubChem CID | 24812703 |
| Molecular Formula | C18H22N4O5 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | azanium 5-[4-(2-methoxyphenyl)piperazin-1-yl]-2-nitrobenzoate |
| SMILES | COc1ccccc1N1CCN(c2ccc([N+](=O)[O-])c(C(=O)[O-])c2)CC1.[NH4+] |
| InChI | InChI=1S/C18H19N3O5.H3N/c1-26-17-5-3-2-4-16(17)20-10-8-19(9-11-20)13-6-7-15(21(24)25)14(12-13)18(22)23;/h2-7,12H,8-11H2,1H3,(H,22,23);1H3 |
| InChIKey | ZLHOZWDOKNBSGW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|