C20H24ClN3O6 — CID 11419230
1-(3,4-dihydroxy-5-nitrophenyl)-3-[4-(2-methoxyphenyl)piperazin-1-yl]propan-1-one;hydrochloride (PubChem CID 11419230) has the molecular formula C20H24ClN3O6 and a molecular weight of 437.88 g/mol. Its IUPAC name is 1-(3,4-dihydroxy-5-nitrophenyl)-3-[4-(2-methoxyphenyl)piperazin-1-yl]propan-1-one;hydrochloride.
| Compound Name | 1-(3,4-dihydroxy-5-nitrophenyl)-3-[4-(2-methoxyphenyl)piperazin-1-yl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 11419230 |
| Molecular Formula | C20H24ClN3O6 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 1-(3,4-dihydroxy-5-nitrophenyl)-3-[4-(2-methoxyphenyl)piperazin-1-yl]propan-1-one;hydrochloride |
| SMILES | COc1ccccc1N1CCN(CCC(=O)c2cc(O)c(O)c([N+](=O)[O-])c2)CC1.Cl |
| InChI | InChI=1S/C20H23N3O6.ClH/c1-29-19-5-3-2-4-15(19)22-10-8-21(9-11-22)7-6-17(24)14-12-16(23(27)28)20(26)18(25)13-14;/h2-5,12-13,25-26H,6-11H2,1H3;1H |
| InChIKey | KZGFOVWNDIVKJI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 116.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|