C20H22ClN3O6 — CID 11419166
3-(4-benzoylpiperazin-1-yl)-1-(3,4-dihydroxy-5-nitrophenyl)propan-1-one;hydrochloride (PubChem CID 11419166) has the molecular formula C20H22ClN3O6 and a molecular weight of 435.86 g/mol. Its IUPAC name is 3-(4-benzoylpiperazin-1-yl)-1-(3,4-dihydroxy-5-nitrophenyl)propan-1-one;hydrochloride.
| Compound Name | 3-(4-benzoylpiperazin-1-yl)-1-(3,4-dihydroxy-5-nitrophenyl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 11419166 |
| Molecular Formula | C20H22ClN3O6 |
| Molecular Weight | 435.86 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 3-(4-benzoylpiperazin-1-yl)-1-(3,4-dihydroxy-5-nitrophenyl)propan-1-one;hydrochloride |
| SMILES | Cl.O=C(CCN1CCN(C(=O)c2ccccc2)CC1)c1cc(O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H21N3O6.ClH/c24-17(15-12-16(23(28)29)19(26)18(25)13-15)6-7-21-8-10-22(11-9-21)20(27)14-4-2-1-3-5-14;/h1-5,12-13,25-26H,6-11H2;1H |
| InChIKey | NYNCIWXTSGIDQQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.86 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|