C19H21ClFN3O5 — CID 11750651
1-(3,4-dihydroxy-5-nitrophenyl)-3-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one;hydrochloride (PubChem CID 11750651) has the molecular formula C19H21ClFN3O5 and a molecular weight of 425.84 g/mol. Its IUPAC name is 1-(3,4-dihydroxy-5-nitrophenyl)-3-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one;hydrochloride.
| Compound Name | 1-(3,4-dihydroxy-5-nitrophenyl)-3-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 11750651 |
| Molecular Formula | C19H21ClFN3O5 |
| Molecular Weight | 425.84 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 1-(3,4-dihydroxy-5-nitrophenyl)-3-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one;hydrochloride |
| SMILES | Cl.O=C(CCN1CCN(c2ccc(F)cc2)CC1)c1cc(O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H20FN3O5.ClH/c20-14-1-3-15(4-2-14)22-9-7-21(8-10-22)6-5-17(24)13-11-16(23(27)28)19(26)18(25)12-13;/h1-4,11-12,25-26H,5-10H2;1H |
| InChIKey | DURKATDEARZDBW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 107.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.84 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|