C18H19ClFN3O5 — CID 11373271
1-(3,4-dihydroxy-5-nitrophenyl)-2-[4-(4-fluorophenyl)piperazin-1-yl]ethanone;hydrochloride (PubChem CID 11373271) has the molecular formula C18H19ClFN3O5 and a molecular weight of 411.82 g/mol. Its IUPAC name is 1-(3,4-dihydroxy-5-nitrophenyl)-2-[4-(4-fluorophenyl)piperazin-1-yl]ethanone;hydrochloride.
| Compound Name | 1-(3,4-dihydroxy-5-nitrophenyl)-2-[4-(4-fluorophenyl)piperazin-1-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 11373271 |
| Molecular Formula | C18H19ClFN3O5 |
| Molecular Weight | 411.82 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 1-(3,4-dihydroxy-5-nitrophenyl)-2-[4-(4-fluorophenyl)piperazin-1-yl]ethanone;hydrochloride |
| SMILES | Cl.O=C(CN1CCN(c2ccc(F)cc2)CC1)c1cc(O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H18FN3O5.ClH/c19-13-1-3-14(4-2-13)21-7-5-20(6-8-21)11-17(24)12-9-15(22(26)27)18(25)16(23)10-12;/h1-4,9-10,23,25H,5-8,11H2;1H |
| InChIKey | YGXXZUWKMMQIGA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 107.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.82 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|