C14H18ClN3O6 — CID 70031509
1-[2-(3,4-dihydroxy-5-nitrophenyl)-2-oxoethyl]piperidine-4-carboxamide;hydrochloride (PubChem CID 70031509) has the molecular formula C14H18ClN3O6 and a molecular weight of 359.77 g/mol. Its IUPAC name is 1-[2-(3,4-dihydroxy-5-nitrophenyl)-2-oxoethyl]piperidine-4-carboxamide;hydrochloride.
| Compound Name | 1-[2-(3,4-dihydroxy-5-nitrophenyl)-2-oxoethyl]piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 70031509 |
| Molecular Formula | C14H18ClN3O6 |
| Molecular Weight | 359.77 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 1-[2-(3,4-dihydroxy-5-nitrophenyl)-2-oxoethyl]piperidine-4-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)C1CCN(CC(=O)c2cc(O)c(O)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C14H17N3O6.ClH/c15-14(21)8-1-3-16(4-2-8)7-12(19)9-5-10(17(22)23)13(20)11(18)6-9;/h5-6,8,18,20H,1-4,7H2,(H2,15,21);1H |
| InChIKey | NHQRPNBTQOOKHR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.77 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|