C20H22N4O3 — CID 46256406
1-(2,3-dihydro-1H-indol-5-yl)-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanone (PubChem CID 46256406) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-indol-5-yl)-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanone.
| Compound Name | 1-(2,3-dihydro-1H-indol-5-yl)-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 46256406 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1-(2,3-dihydro-1H-indol-5-yl)-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CN1CCN(c2ccc([N+](=O)[O-])cc2)CC1)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C20H22N4O3/c25-20(16-1-6-19-15(13-16)7-8-21-19)14-22-9-11-23(12-10-22)17-2-4-18(5-3-17)24(26)27/h1-6,13,21H,7-12,14H2 |
| InChIKey | YEBBTYSAEBBHFJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|