C15H13N7 — CID 110455135
4-N-(5-imidazol-1-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)benzene-1,4-diamine (PubChem CID 110455135) has the molecular formula C15H13N7 and a molecular weight of 291.32 g/mol. Its IUPAC name is 4-N-(5-imidazol-1-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)benzene-1,4-diamine.
| Compound Name | 4-N-(5-imidazol-1-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 110455135 |
| Molecular Formula | C15H13N7 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 4-N-(5-imidazol-1-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2nc3cccc(-n4ccnc4)n3n2)cc1 |
| InChI | InChI=1S/C15H13N7/c16-11-4-6-12(7-5-11)18-15-19-13-2-1-3-14(22(13)20-15)21-9-8-17-10-21/h1-10H,16H2,(H,18,20) |
| InChIKey | MXLGAIPJMZWNRB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|