C16H15N7 — CID 110455147
4-N-(6-imidazol-1-yl-8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)benzene-1,4-diamine (PubChem CID 110455147) has the molecular formula C16H15N7 and a molecular weight of 305.35 g/mol. Its IUPAC name is 4-N-(6-imidazol-1-yl-8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)benzene-1,4-diamine.
| Compound Name | 4-N-(6-imidazol-1-yl-8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 110455147 |
| Molecular Formula | C16H15N7 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 4-N-(6-imidazol-1-yl-8-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)benzene-1,4-diamine |
| SMILES | Cc1cc(-n2ccnc2)cn2nc(Nc3ccc(N)cc3)nc12 |
| InChI | InChI=1S/C16H15N7/c1-11-8-14(22-7-6-18-10-22)9-23-15(11)20-16(21-23)19-13-4-2-12(17)3-5-13/h2-10H,17H2,1H3,(H,19,21) |
| InChIKey | WJWOFDMTAJTNKH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|