C17H20N2O4 — CID 110458657
1-[(3,4,5-trimethoxyphenyl)methyl]-6,7-dihydro-5H-indazol-4-one (PubChem CID 110458657) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 1-[(3,4,5-trimethoxyphenyl)methyl]-6,7-dihydro-5H-indazol-4-one.
| Compound Name | 1-[(3,4,5-trimethoxyphenyl)methyl]-6,7-dihydro-5H-indazol-4-one |
|---|---|
| PubChem CID | 110458657 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-[(3,4,5-trimethoxyphenyl)methyl]-6,7-dihydro-5H-indazol-4-one |
| SMILES | COc1cc(Cn2ncc3c2CCCC3=O)cc(OC)c1OC |
| InChI | InChI=1S/C17H20N2O4/c1-21-15-7-11(8-16(22-2)17(15)23-3)10-19-13-5-4-6-14(20)12(13)9-18-19/h7-9H,4-6,10H2,1-3H3 |
| InChIKey | BDEACDRXCAXCTE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |