C20H26O3S — CID 11046244
methyl 6-oxo-6-[(1S,2R,3S,4R)-3-phenylsulfanyl-2-bicyclo[2.2.1]heptanyl]hexanoate (PubChem CID 11046244) has the molecular formula C20H26O3S and a molecular weight of 346.49 g/mol. Its IUPAC name is methyl 6-oxo-6-[(1S,2R,3S,4R)-3-phenylsulfanyl-2-bicyclo[2.2.1]heptanyl]hexanoate.
| Compound Name | methyl 6-oxo-6-[(1S,2R,3S,4R)-3-phenylsulfanyl-2-bicyclo[2.2.1]heptanyl]hexanoate |
|---|---|
| PubChem CID | 11046244 |
| Molecular Formula | C20H26O3S |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | methyl 6-oxo-6-[(1S,2R,3S,4R)-3-phenylsulfanyl-2-bicyclo[2.2.1]heptanyl]hexanoate |
| SMILES | COC(=O)CCCCC(=O)[C@H]1[C@H]2CC[C@H](C2)[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C20H26O3S/c1-23-18(22)10-6-5-9-17(21)19-14-11-12-15(13-14)20(19)24-16-7-3-2-4-8-16/h2-4,7-8,14-15,19-20H,5-6,9-13H2,1H3/t14-,15+,19+,20-/m0/s1 |
| InChIKey | ATMZDIIPBMRLSB-BWMZKYQQSA-N |
| XLogP | 4.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|