C21H28O3S — CID 11142931
methyl 7-oxo-7-[(1S,2R,3S,4R)-3-phenylsulfanyl-2-bicyclo[2.2.1]heptanyl]heptanoate (PubChem CID 11142931) has the molecular formula C21H28O3S and a molecular weight of 360.52 g/mol. Its IUPAC name is methyl 7-oxo-7-[(1S,2R,3S,4R)-3-phenylsulfanyl-2-bicyclo[2.2.1]heptanyl]heptanoate.
| Compound Name | methyl 7-oxo-7-[(1S,2R,3S,4R)-3-phenylsulfanyl-2-bicyclo[2.2.1]heptanyl]heptanoate |
|---|---|
| PubChem CID | 11142931 |
| Molecular Formula | C21H28O3S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | methyl 7-oxo-7-[(1S,2R,3S,4R)-3-phenylsulfanyl-2-bicyclo[2.2.1]heptanyl]heptanoate |
| SMILES | COC(=O)CCCCCC(=O)[C@H]1[C@H]2CC[C@H](C2)[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C21H28O3S/c1-24-19(23)11-7-3-6-10-18(22)20-15-12-13-16(14-15)21(20)25-17-8-4-2-5-9-17/h2,4-5,8-9,15-16,20-21H,3,6-7,10-14H2,1H3/t15-,16+,20+,21-/m0/s1 |
| InChIKey | SFLKWCIYOIMJED-HDIOYNLWSA-N |
| XLogP | 4.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|