C18H18O3S — CID 134881495
methyl 2-oxo-2-[(1R,2S,5R,6S)-4-phenylsulfanyl-3-tricyclo[4.2.1.02,5]non-7-enyl]acetate (PubChem CID 134881495) has the molecular formula C18H18O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is methyl 2-oxo-2-[(1R,2S,5R,6S)-4-phenylsulfanyl-3-tricyclo[4.2.1.02,5]non-7-enyl]acetate.
| Compound Name | methyl 2-oxo-2-[(1R,2S,5R,6S)-4-phenylsulfanyl-3-tricyclo[4.2.1.02,5]non-7-enyl]acetate |
|---|---|
| PubChem CID | 134881495 |
| Molecular Formula | C18H18O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | methyl 2-oxo-2-[(1R,2S,5R,6S)-4-phenylsulfanyl-3-tricyclo[4.2.1.02,5]non-7-enyl]acetate |
| SMILES | COC(=O)C(=O)C1C(Sc2ccccc2)[C@H]2[C@@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C18H18O3S/c1-21-18(20)16(19)15-13-10-7-8-11(9-10)14(13)17(15)22-12-5-3-2-4-6-12/h2-8,10-11,13-15,17H,9H2,1H3/t10-,11+,13-,14+,15?,17?/m0/s1 |
| InChIKey | LANSFRYAZZWQIC-PHZLXZQSSA-N |
| XLogP | 2.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|