C25H30O3S2 — CID 135012637
[2-[(1S,5R)-5-[bis(phenylsulfanyl)methyl]-2,2,3-trimethylcyclopentyl]-2-oxoethyl] acetate (PubChem CID 135012637) has the molecular formula C25H30O3S2 and a molecular weight of 442.65 g/mol. Its IUPAC name is [2-[(1S,5R)-5-[bis(phenylsulfanyl)methyl]-2,2,3-trimethylcyclopentyl]-2-oxoethyl] acetate.
| Compound Name | [2-[(1S,5R)-5-[bis(phenylsulfanyl)methyl]-2,2,3-trimethylcyclopentyl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 135012637 |
| Molecular Formula | C25H30O3S2 |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | [2-[(1S,5R)-5-[bis(phenylsulfanyl)methyl]-2,2,3-trimethylcyclopentyl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@H]1[C@H](C(Sc2ccccc2)Sc2ccccc2)CC(C)C1(C)C |
| InChI | InChI=1S/C25H30O3S2/c1-17-15-21(23(25(17,3)4)22(27)16-28-18(2)26)24(29-19-11-7-5-8-12-19)30-20-13-9-6-10-14-20/h5-14,17,21,23-24H,15-16H2,1-4H3/t17?,21-,23-/m1/s1 |
| InChIKey | NIOKYKDYGQEVNQ-XQAYDEMESA-N |
| XLogP | 6.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|