C24H42N2O — CID 11047010
(1S,2R,7S,8R)-4,10-dihexyl-2,11-dimethyl-4,10-diazatricyclo[6.2.2.02,7]dodec-11-en-9-one (PubChem CID 11047010) has the molecular formula C24H42N2O and a molecular weight of 374.61 g/mol. Its IUPAC name is (1S,2R,7S,8R)-4,10-dihexyl-2,11-dimethyl-4,10-diazatricyclo[6.2.2.02,7]dodec-11-en-9-one.
| Compound Name | (1S,2R,7S,8R)-4,10-dihexyl-2,11-dimethyl-4,10-diazatricyclo[6.2.2.02,7]dodec-11-en-9-one |
|---|---|
| PubChem CID | 11047010 |
| Molecular Formula | C24H42N2O |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.33 |
| IUPAC Name | (1S,2R,7S,8R)-4,10-dihexyl-2,11-dimethyl-4,10-diazatricyclo[6.2.2.02,7]dodec-11-en-9-one |
| SMILES | CCCCCCN1CC[C@H]2[C@H]3C=C(C)[C@H](N(CCCCCC)C3=O)[C@@]2(C)C1 |
| InChI | InChI=1S/C24H42N2O/c1-5-7-9-11-14-25-16-13-21-20-17-19(3)22(24(21,4)18-25)26(23(20)27)15-12-10-8-6-2/h17,20-22H,5-16,18H2,1-4H3/t20-,21+,22+,24+/m1/s1 |
| InChIKey | LRIBJJPISBLTAG-VCHRRKICSA-N |
| XLogP | 5.26 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|