C10H6N4OS — CID 110471770
N-(3-cyano-2-pyridinyl)-1,3-thiazole-4-carboxamide (PubChem CID 110471770) has the molecular formula C10H6N4OS and a molecular weight of 230.25 g/mol. Its IUPAC name is N-(3-cyano-2-pyridinyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(3-cyano-2-pyridinyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 110471770 |
| Molecular Formula | C10H6N4OS |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | N-(3-cyano-2-pyridinyl)-1,3-thiazole-4-carboxamide |
| SMILES | N#Cc1cccnc1NC(=O)c1cscn1 |
| InChI | InChI=1S/C10H6N4OS/c11-4-7-2-1-3-12-9(7)14-10(15)8-5-16-6-13-8/h1-3,5-6H,(H,12,14,15) |
| InChIKey | MITMGNIZQRAVSO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |