C9H6FN3OS — CID 155658858
N-(3-fluoro-2-pyridinyl)-1,3-thiazole-4-carboxamide (PubChem CID 155658858) has the molecular formula C9H6FN3OS and a molecular weight of 223.23 g/mol. Its IUPAC name is N-(3-fluoro-2-pyridinyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(3-fluoro-2-pyridinyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 155658858 |
| Molecular Formula | C9H6FN3OS |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | N-(3-fluoro-2-pyridinyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ncccc1F)c1cscn1 |
| InChI | InChI=1S/C9H6FN3OS/c10-6-2-1-3-11-8(6)13-9(14)7-4-15-5-12-7/h1-5H,(H,11,13,14) |
| InChIKey | XRMVDZHVWQZICW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |