C18H25BrO4 — CID 11047269
[(2R,3S,6S)-2,6-dimethyl-7-oxo-1-phenylmethoxyheptan-3-yl] 2-bromoacetate (PubChem CID 11047269) has the molecular formula C18H25BrO4 and a molecular weight of 385.30 g/mol. Its IUPAC name is [(2R,3S,6S)-2,6-dimethyl-7-oxo-1-phenylmethoxyheptan-3-yl] 2-bromoacetate.
| Compound Name | [(2R,3S,6S)-2,6-dimethyl-7-oxo-1-phenylmethoxyheptan-3-yl] 2-bromoacetate |
|---|---|
| PubChem CID | 11047269 |
| Molecular Formula | C18H25BrO4 |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | [(2R,3S,6S)-2,6-dimethyl-7-oxo-1-phenylmethoxyheptan-3-yl] 2-bromoacetate |
| SMILES | C[C@H](C=O)CC[C@H](OC(=O)CBr)[C@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C18H25BrO4/c1-14(11-20)8-9-17(23-18(21)10-19)15(2)12-22-13-16-6-4-3-5-7-16/h3-7,11,14-15,17H,8-10,12-13H2,1-2H3/t14-,15+,17-/m0/s1 |
| InChIKey | LREKRTRMTKLYMH-UXLLHSPISA-N |
| XLogP | 3.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|