C7H7N7O — CID 110484750
5-amino-N-pyrimidin-2-yl-2H-triazole-4-carboxamide (PubChem CID 110484750) has the molecular formula C7H7N7O and a molecular weight of 205.18 g/mol. Its IUPAC name is 5-amino-N-pyrimidin-2-yl-2H-triazole-4-carboxamide.
| Compound Name | 5-amino-N-pyrimidin-2-yl-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 110484750 |
| Molecular Formula | C7H7N7O |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 5-amino-N-pyrimidin-2-yl-2H-triazole-4-carboxamide |
| SMILES | Nc1n[nH]nc1C(=O)Nc1ncccn1 |
| InChI | InChI=1S/C7H7N7O/c8-5-4(12-14-13-5)6(15)11-7-9-2-1-3-10-7/h1-3H,(H3,8,12,13,14)(H,9,10,11,15) |
| InChIKey | NMFPMNFAPWWVDT-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |