C15H17FN2O2 — CID 110489754
7-fluoro-N-(5-hydroxypentyl)quinoline-3-carboxamide (PubChem CID 110489754) has the molecular formula C15H17FN2O2 and a molecular weight of 276.31 g/mol. Its IUPAC name is 7-fluoro-N-(5-hydroxypentyl)quinoline-3-carboxamide.
| Compound Name | 7-fluoro-N-(5-hydroxypentyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 110489754 |
| Molecular Formula | C15H17FN2O2 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 7-fluoro-N-(5-hydroxypentyl)quinoline-3-carboxamide |
| SMILES | O=C(NCCCCCO)c1cnc2cc(F)ccc2c1 |
| InChI | InChI=1S/C15H17FN2O2/c16-13-5-4-11-8-12(10-18-14(11)9-13)15(20)17-6-2-1-3-7-19/h4-5,8-10,19H,1-3,6-7H2,(H,17,20) |
| InChIKey | DBFCOHSHIGNAPO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|