C15H11ClN2O3 — CID 110494897
(2-methyl-1,3-benzoxazol-5-yl) N-(4-chlorophenyl)carbamate (PubChem CID 110494897) has the molecular formula C15H11ClN2O3 and a molecular weight of 302.72 g/mol. Its IUPAC name is (2-methyl-1,3-benzoxazol-5-yl) N-(4-chlorophenyl)carbamate.
| Compound Name | (2-methyl-1,3-benzoxazol-5-yl) N-(4-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 110494897 |
| Molecular Formula | C15H11ClN2O3 |
| Molecular Weight | 302.72 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | (2-methyl-1,3-benzoxazol-5-yl) N-(4-chlorophenyl)carbamate |
| SMILES | Cc1nc2cc(OC(=O)Nc3ccc(Cl)cc3)ccc2o1 |
| InChI | InChI=1S/C15H11ClN2O3/c1-9-17-13-8-12(6-7-14(13)20-9)21-15(19)18-11-4-2-10(16)3-5-11/h2-8H,1H3,(H,18,19) |
| InChIKey | VTUXKRZMZWAEDV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.72 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |