C19H22FN5O5S — CID 110497991
4-fluoro-N-[1-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]-1-oxobutan-2-yl]benzenesulfonamide (PubChem CID 110497991) has the molecular formula C19H22FN5O5S and a molecular weight of 451.48 g/mol. Its IUPAC name is 4-fluoro-N-[1-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]-1-oxobutan-2-yl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[1-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]-1-oxobutan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 110497991 |
| Molecular Formula | C19H22FN5O5S |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 4-fluoro-N-[1-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]-1-oxobutan-2-yl]benzenesulfonamide |
| SMILES | CCC(NS(=O)(=O)c1ccc(F)cc1)C(=O)N1CCN(c2ccc([N+](=O)[O-])cn2)CC1 |
| InChI | InChI=1S/C19H22FN5O5S/c1-2-17(22-31(29,30)16-6-3-14(20)4-7-16)19(26)24-11-9-23(10-12-24)18-8-5-15(13-21-18)25(27)28/h3-8,13,17,22H,2,9-12H2,1H3 |
| InChIKey | ZDGQRVXEWSAOCE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 125.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|