C23H26N4O — CID 110501775
N-[2-(1H-benzimidazol-2-yl)ethyl]-1,5-diethyl-3-methylindole-2-carboxamide (PubChem CID 110501775) has the molecular formula C23H26N4O and a molecular weight of 374.49 g/mol. Its IUPAC name is N-[2-(1H-benzimidazol-2-yl)ethyl]-1,5-diethyl-3-methylindole-2-carboxamide.
| Compound Name | N-[2-(1H-benzimidazol-2-yl)ethyl]-1,5-diethyl-3-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 110501775 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | N-[2-(1H-benzimidazol-2-yl)ethyl]-1,5-diethyl-3-methylindole-2-carboxamide |
| SMILES | CCc1ccc2c(c1)c(C)c(C(=O)NCCc1nc3ccccc3[nH]1)n2CC |
| InChI | InChI=1S/C23H26N4O/c1-4-16-10-11-20-17(14-16)15(3)22(27(20)5-2)23(28)24-13-12-21-25-18-8-6-7-9-19(18)26-21/h6-11,14H,4-5,12-13H2,1-3H3,(H,24,28)(H,25,26) |
| InChIKey | VPKDEFVLECYYPU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|