C11H7F3N4OS — CID 110507970
3-sulfanylidene-4-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-2H-1,2,4-triazin-5-one (PubChem CID 110507970) has the molecular formula C11H7F3N4OS and a molecular weight of 300.27 g/mol. Its IUPAC name is 3-sulfanylidene-4-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-2H-1,2,4-triazin-5-one.
| Compound Name | 3-sulfanylidene-4-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-2H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 110507970 |
| Molecular Formula | C11H7F3N4OS |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 3-sulfanylidene-4-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-2H-1,2,4-triazin-5-one |
| SMILES | O=c1cn[nH]c(=S)n1/N=C\c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C11H7F3N4OS/c12-11(13,14)8-4-2-1-3-7(8)5-16-18-9(19)6-15-17-10(18)20/h1-6H,(H,17,20)/b16-5- |
| InChIKey | DISWIKMDBCOVSJ-BNCCVWRVSA-N |
| XLogP | 2.20 |
| TPSA | 63.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|