C13H17Cl2N3OS — CID 110508390
1-[(E)-[3,5-dichloro-4-(2-methylpropoxy)phenyl]methylideneamino]-3-methylthiourea (PubChem CID 110508390) has the molecular formula C13H17Cl2N3OS and a molecular weight of 334.27 g/mol. Its IUPAC name is 1-[(E)-[3,5-dichloro-4-(2-methylpropoxy)phenyl]methylideneamino]-3-methylthiourea.
| Compound Name | 1-[(E)-[3,5-dichloro-4-(2-methylpropoxy)phenyl]methylideneamino]-3-methylthiourea |
|---|---|
| PubChem CID | 110508390 |
| Molecular Formula | C13H17Cl2N3OS |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 1-[(E)-[3,5-dichloro-4-(2-methylpropoxy)phenyl]methylideneamino]-3-methylthiourea |
| SMILES | CNC(=S)N/N=C/c1cc(Cl)c(OCC(C)C)c(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2N3OS/c1-8(2)7-19-12-10(14)4-9(5-11(12)15)6-17-18-13(20)16-3/h4-6,8H,7H2,1-3H3,(H2,16,18,20)/b17-6+ |
| InChIKey | KSFZEFIWEQCOCP-UBKPWBPPSA-N |
| XLogP | 3.46 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|