C48H30K2O8P2S2 — CID 11051291
dipotassium;8-diphenylphosphanyl-9-(2-diphenylphosphanyl-8-sulfonatodibenzofuran-1-yl)dibenzofuran-2-sulfonate (PubChem CID 11051291) has the molecular formula C48H30K2O8P2S2 and a molecular weight of 939.04 g/mol. Its IUPAC name is dipotassium;8-diphenylphosphanyl-9-(2-diphenylphosphanyl-8-sulfonatodibenzofuran-1-yl)dibenzofuran-2-sulfonate.
| Compound Name | dipotassium;8-diphenylphosphanyl-9-(2-diphenylphosphanyl-8-sulfonatodibenzofuran-1-yl)dibenzofuran-2-sulfonate |
|---|---|
| PubChem CID | 11051291 |
| Molecular Formula | C48H30K2O8P2S2 |
| Molecular Weight | 939.04 g/mol |
| Exact Mass | 938.01 |
| IUPAC Name | dipotassium;8-diphenylphosphanyl-9-(2-diphenylphosphanyl-8-sulfonatodibenzofuran-1-yl)dibenzofuran-2-sulfonate |
| SMILES | O=S(=O)([O-])c1ccc2oc3ccc(P(c4ccccc4)c4ccccc4)c(-c4c(P(c5ccccc5)c5ccccc5)ccc5oc6ccc(S(=O)(=O)[O-])cc6c45)c3c2c1.[K+].[K+] |
| InChI | InChI=1S/C48H32O8P2S2.2K/c49-59(50,51)35-21-23-39-37(29-35)45-41(55-39)25-27-43(57(31-13-5-1-6-14-31)32-15-7-2-8-16-32)47(45)48-44(58(33-17-9-3-10-18-33)34-19-11-4-12-20-34)28-26-42-46(48)38-30-36(60(52,53)54)22-24-40(38)56-42;;/h1-30H,(H,49,50,51)(H,52,53,54);;/q;2*+1/p-2 |
| InChIKey | FOBRHLHVUMCOOY-UHFFFAOYSA-L |
| XLogP | 2.48 |
| TPSA | 140.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.04 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|