C20H25N2O6PS2 — CID 118690082
diazanium;4-methyl-3-[(2-methyl-5-sulfonatophenyl)-phenylphosphanyl]benzenesulfonate (PubChem CID 118690082) has the molecular formula C20H25N2O6PS2 and a molecular weight of 484.54 g/mol. Its IUPAC name is diazanium;4-methyl-3-[(2-methyl-5-sulfonatophenyl)-phenylphosphanyl]benzenesulfonate.
| Compound Name | diazanium;4-methyl-3-[(2-methyl-5-sulfonatophenyl)-phenylphosphanyl]benzenesulfonate |
|---|---|
| PubChem CID | 118690082 |
| Molecular Formula | C20H25N2O6PS2 |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | diazanium;4-methyl-3-[(2-methyl-5-sulfonatophenyl)-phenylphosphanyl]benzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1P(c1ccccc1)c1cc(S(=O)(=O)[O-])ccc1C.[NH4+].[NH4+] |
| InChI | InChI=1S/C20H19O6PS2.2H3N/c1-14-8-10-17(28(21,22)23)12-19(14)27(16-6-4-3-5-7-16)20-13-18(29(24,25)26)11-9-15(20)2;;/h3-13H,1-2H3,(H,21,22,23)(H,24,25,26);2*1H3 |
| InChIKey | KPWRTYRARHZLFH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 187.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|