C25H32NO3PS — CID 118689812
3-diphenylphosphanyl-4-methylbenzenesulfonate;triethylazanium (PubChem CID 118689812) has the molecular formula C25H32NO3PS and a molecular weight of 457.58 g/mol. Its IUPAC name is 3-diphenylphosphanyl-4-methylbenzenesulfonate;triethylazanium.
| Compound Name | 3-diphenylphosphanyl-4-methylbenzenesulfonate;triethylazanium |
|---|---|
| PubChem CID | 118689812 |
| Molecular Formula | C25H32NO3PS |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 3-diphenylphosphanyl-4-methylbenzenesulfonate;triethylazanium |
| SMILES | CC[NH+](CC)CC.Cc1ccc(S(=O)(=O)[O-])cc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H17O3PS.C6H15N/c1-15-12-13-18(24(20,21)22)14-19(15)23(16-8-4-2-5-9-16)17-10-6-3-7-11-17;1-4-7(5-2)6-3/h2-14H,1H3,(H,20,21,22);4-6H2,1-3H3 |
| InChIKey | PLFWFGZAZBPWCJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 61.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|