C69H123N2O6PS2 — CID 118689816
4-methyl-3-[(2-methylphenyl)-(2-methyl-5-sulfonatophenyl)phosphanyl]benzenesulfonate;bis(trioctylazanium) (PubChem CID 118689816) has the molecular formula C69H123N2O6PS2 and a molecular weight of 1171.86 g/mol. Its IUPAC name is 4-methyl-3-[(2-methylphenyl)-(2-methyl-5-sulfonatophenyl)phosphanyl]benzenesulfonate;bis(trioctylazanium).
| Compound Name | 4-methyl-3-[(2-methylphenyl)-(2-methyl-5-sulfonatophenyl)phosphanyl]benzenesulfonate;bis(trioctylazanium) |
|---|---|
| PubChem CID | 118689816 |
| Molecular Formula | C69H123N2O6PS2 |
| Molecular Weight | 1171.86 g/mol |
| Exact Mass | 1170.86 |
| IUPAC Name | 4-methyl-3-[(2-methylphenyl)-(2-methyl-5-sulfonatophenyl)phosphanyl]benzenesulfonate;bis(trioctylazanium) |
| SMILES | CCCCCCCC[NH+](CCCCCCCC)CCCCCCCC.CCCCCCCC[NH+](CCCCCCCC)CCCCCCCC.Cc1ccccc1P(c1cc(S(=O)(=O)[O-])ccc1C)c1cc(S(=O)(=O)[O-])ccc1C |
| InChI | InChI=1S/2C24H51N.C21H21O6PS2/c2*1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-14-6-4-5-7-19(14)28(20-12-17(29(22,23)24)10-8-15(20)2)21-13-18(30(25,26)27)11-9-16(21)3/h2*4-24H2,1-3H3;4-13H,1-3H3,(H,22,23,24)(H,25,26,27) |
| InChIKey | VCEYNYGGQARSOG-UHFFFAOYSA-N |
| XLogP | 16.08 |
| TPSA | 123.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1171.86 |
| LogP ≤ 5 | 16.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|